ChemNet > CAS > 175202-60-5 (3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol
175202-60-5 (3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol
| product Name |
(3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol |
| CAS No |
175202-60-5 |
| Molecular Formula |
C9H10OS2 |
| Molecular Weight |
198.3051 |
| InChI |
InChI=1/C9H10OS2/c1-5-4-11-9-8(5)6(2)7(3-10)12-9/h4,10H,3H2,1-2H3 |
| Molecular Structure |
![175202-60-5 (3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol](https://images-a.chemnet.com/suppliers/chembase/cas11/cas175202-60-5.gif)
|
| Density |
1.332g/cm3 |
| Melting point |
144.5℃ |
| Boiling point |
367.1°C at 760 mmHg |
| Refractive index |
1.69 |
| Flash point |
175.8°C |
| Vapour Pressur |
4.9E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
